C21H23NO4 — CID 11187318
tert-butyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-1-benzylaziridine-2-carboxylate (PubChem CID 11187318) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-1-benzylaziridine-2-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-1-benzylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11187318 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | tert-butyl (2R,3S)-3-(1,3-benzodioxol-5-yl)-1-benzylaziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](c2ccc3c(c2)OCO3)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-21(2,3)26-20(23)19-18(22(19)12-14-7-5-4-6-8-14)15-9-10-16-17(11-15)25-13-24-16/h4-11,18-19H,12-13H2,1-3H3/t18-,19+,22?/m0/s1 |
| InChIKey | MWQRAAXNFBFYGT-ZKTCVHQMSA-N |
| XLogP | 3.68 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|