C19H22N2O2 — CID 10804908
tert-butyl (2S,3R)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate (PubChem CID 10804908) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl (2S,3R)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate.
| Compound Name | tert-butyl (2S,3R)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10804908 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl (2S,3R)-1-benzyl-3-pyridin-2-ylaziridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1[C@H](c2ccccn2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-19(2,3)23-18(22)17-16(15-11-7-8-12-20-15)21(17)13-14-9-5-4-6-10-14/h4-12,16-17H,13H2,1-3H3/t16-,17-,21?/m0/s1 |
| InChIKey | UUPXZOWPWAAWQD-MVWJYJSVSA-N |
| XLogP | 3.35 |
| TPSA | 42.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|