C18H19NO2 — CID 12064962
ethyl (2R,3S)-1-benzyl-3-phenylaziridine-2-carboxylate (PubChem CID 12064962) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl (2R,3S)-1-benzyl-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2R,3S)-1-benzyl-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 12064962 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl (2R,3S)-1-benzyl-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-2-21-18(20)17-16(15-11-7-4-8-12-15)19(17)13-14-9-5-3-6-10-14/h3-12,16-17H,2,13H2,1H3/t16-,17+,19?/m0/s1 |
| InChIKey | DDGRODSGRHVJLF-PZEDNMLSSA-N |
| XLogP | 3.18 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|