C33H31NO4S — CID 138377492
ethyl 3,4-dibenzoyl-1-benzyl-5-(5-methylthiophen-2-yl)pyrrolidine-2-carboxylate (PubChem CID 138377492) has the molecular formula C33H31NO4S and a molecular weight of 537.68 g/mol. Its IUPAC name is ethyl 3,4-dibenzoyl-1-benzyl-5-(5-methylthiophen-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 3,4-dibenzoyl-1-benzyl-5-(5-methylthiophen-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138377492 |
| Molecular Formula | C33H31NO4S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | ethyl 3,4-dibenzoyl-1-benzyl-5-(5-methylthiophen-2-yl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1C(C(=O)c2ccccc2)C(C(=O)c2ccccc2)C(c2ccc(C)s2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H31NO4S/c1-3-38-33(37)30-28(32(36)25-17-11-6-12-18-25)27(31(35)24-15-9-5-10-16-24)29(26-20-19-22(2)39-26)34(30)21-23-13-7-4-8-14-23/h4-20,27-30H,3,21H2,1-2H3 |
| InChIKey | WMZVZDNKDRIGGB-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |