C17H17NO — CID 23243955
1-[(2S,3S)-1-benzyl-3-phenylaziridin-2-yl]ethanone (PubChem CID 23243955) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[(2S,3S)-1-benzyl-3-phenylaziridin-2-yl]ethanone.
| Compound Name | 1-[(2S,3S)-1-benzyl-3-phenylaziridin-2-yl]ethanone |
|---|---|
| PubChem CID | 23243955 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-[(2S,3S)-1-benzyl-3-phenylaziridin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-13(19)16-17(15-10-6-3-7-11-15)18(16)12-14-8-4-2-5-9-14/h2-11,16-17H,12H2,1H3/t16-,17+,18?/m1/s1 |
| InChIKey | HRMMIHNNZZNMDC-DVKDBIPTSA-N |
| XLogP | 3.20 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|