C22H19BrN2O — CID 154713687
(2R,3S)-1-benzyl-3-(4-bromophenyl)-N-phenylaziridine-2-carboxamide (PubChem CID 154713687) has the molecular formula C22H19BrN2O and a molecular weight of 407.31 g/mol. Its IUPAC name is (2R,3S)-1-benzyl-3-(4-bromophenyl)-N-phenylaziridine-2-carboxamide.
| Compound Name | (2R,3S)-1-benzyl-3-(4-bromophenyl)-N-phenylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 154713687 |
| Molecular Formula | C22H19BrN2O |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (2R,3S)-1-benzyl-3-(4-bromophenyl)-N-phenylaziridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@H]1[C@H](c2ccc(Br)cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H19BrN2O/c23-18-13-11-17(12-14-18)20-21(22(26)24-19-9-5-2-6-10-19)25(20)15-16-7-3-1-4-8-16/h1-14,20-21H,15H2,(H,24,26)/t20-,21+,25?/m0/s1 |
| InChIKey | XPOSLFOQLHFDJA-SXNCYPNXSA-N |
| XLogP | 5.01 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|