C26H22BrNO3 — CID 124780827
(1R,2R,5R,6S)-6-[(4-bromophenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 124780827) has the molecular formula C26H22BrNO3 and a molecular weight of 476.37 g/mol. Its IUPAC name is (1R,2R,5R,6S)-6-[(4-bromophenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,2R,5R,6S)-6-[(4-bromophenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 124780827 |
| Molecular Formula | C26H22BrNO3 |
| Molecular Weight | 476.37 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (1R,2R,5R,6S)-6-[(4-bromophenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(Br)cc1)[C@@H]1[C@H](C(=O)O)[C@H](c2ccccc2)C=C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H22BrNO3/c27-19-11-13-20(14-12-19)28-25(29)23-21(17-7-3-1-4-8-17)15-16-22(24(23)26(30)31)18-9-5-2-6-10-18/h1-16,21-24H,(H,28,29)(H,30,31)/t21-,22-,23-,24+/m0/s1 |
| InChIKey | UDZMUZLAPFJGPK-NEWJYFPISA-N |
| XLogP | 5.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|