C27H24NO3- — CID 11911074
(1S,2S,5R,6S)-6-[(4-methylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylate (PubChem CID 11911074) has the molecular formula C27H24NO3- and a molecular weight of 410.49 g/mol. Its IUPAC name is (1S,2S,5R,6S)-6-[(4-methylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1S,2S,5R,6S)-6-[(4-methylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11911074 |
| Molecular Formula | C27H24NO3- |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (1S,2S,5R,6S)-6-[(4-methylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@@H](C(=O)[O-])[C@@H](c3ccccc3)C=C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NO3/c1-18-12-14-21(15-13-18)28-26(29)24-22(19-8-4-2-5-9-19)16-17-23(25(24)27(30)31)20-10-6-3-7-11-20/h2-17,22-25H,1H3,(H,28,29)(H,30,31)/p-1/t22-,23+,24-,25-/m0/s1 |
| InChIKey | NOCDKRIOXMJXFY-NDBXHCKUSA-M |
| XLogP | 4.05 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|