C28H27NO3 — CID 11943960
(1S,2S,5R,6R)-6-[(3,4-dimethylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 11943960) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (1S,2S,5R,6R)-6-[(3,4-dimethylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,2S,5R,6R)-6-[(3,4-dimethylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 11943960 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (1S,2S,5R,6R)-6-[(3,4-dimethylphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@@H](C(=O)O)[C@@H](c3ccccc3)C=C[C@H]2c2ccccc2)cc1C |
| InChI | InChI=1S/C28H27NO3/c1-18-13-14-22(17-19(18)2)29-27(30)25-23(20-9-5-3-6-10-20)15-16-24(26(25)28(31)32)21-11-7-4-8-12-21/h3-17,23-26H,1-2H3,(H,29,30)(H,31,32)/t23-,24+,25+,26-/m0/s1 |
| InChIKey | PSFJYEHLBFZVHQ-QUMGSSFMSA-N |
| XLogP | 5.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|