C27H25NO4 — CID 3104487
6-[(3-methoxyphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid (PubChem CID 3104487) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(3-methoxyphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 3104487 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 6-[(3-methoxyphenyl)carbamoyl]-2,5-diphenylcyclohex-3-ene-1-carboxylic acid |
| SMILES | COc1cccc(NC(=O)C2C(c3ccccc3)C=CC(c3ccccc3)C2C(=O)O)c1 |
| InChI | InChI=1S/C27H25NO4/c1-32-21-14-8-13-20(17-21)28-26(29)24-22(18-9-4-2-5-10-18)15-16-23(25(24)27(30)31)19-11-6-3-7-12-19/h2-17,22-25H,1H3,(H,28,29)(H,30,31) |
| InChIKey | BDBQZBKNCSMFIA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|