C18H17NO4 — CID 826005
(3R,5R)-N-(3-methoxyphenyl)-2-oxo-5-phenyloxolane-3-carboxamide (PubChem CID 826005) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3R,5R)-N-(3-methoxyphenyl)-2-oxo-5-phenyloxolane-3-carboxamide.
| Compound Name | (3R,5R)-N-(3-methoxyphenyl)-2-oxo-5-phenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 826005 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3R,5R)-N-(3-methoxyphenyl)-2-oxo-5-phenyloxolane-3-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@H]2C[C@H](c3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C18H17NO4/c1-22-14-9-5-8-13(10-14)19-17(20)15-11-16(23-18(15)21)12-6-3-2-4-7-12/h2-10,15-16H,11H2,1H3,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | YFBNHCLSKKNWGJ-HZPDHXFCSA-N |
| XLogP | 2.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|