C18H17NO3S — CID 163833903
N-(3-methoxyphenyl)-5-phenylsulfanyl-2,3-dihydrofuran-2-carboxamide (PubChem CID 163833903) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5-phenylsulfanyl-2,3-dihydrofuran-2-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-5-phenylsulfanyl-2,3-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 163833903 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(3-methoxyphenyl)-5-phenylsulfanyl-2,3-dihydrofuran-2-carboxamide |
| SMILES | COc1cccc(NC(=O)C2CC=C(Sc3ccccc3)O2)c1 |
| InChI | InChI=1S/C18H17NO3S/c1-21-14-7-5-6-13(12-14)19-18(20)16-10-11-17(22-16)23-15-8-3-2-4-9-15/h2-9,11-12,16H,10H2,1H3,(H,19,20) |
| InChIKey | OGANFMYTWAJKJI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |