C30H25NO4 — CID 124724571
(1R,2R,3S,4R)-3-[(4-acetylphenyl)carbamoyl]-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 124724571) has the molecular formula C30H25NO4 and a molecular weight of 463.53 g/mol. Its IUPAC name is (1R,2R,3S,4R)-3-[(4-acetylphenyl)carbamoyl]-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4R)-3-[(4-acetylphenyl)carbamoyl]-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124724571 |
| Molecular Formula | C30H25NO4 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (1R,2R,3S,4R)-3-[(4-acetylphenyl)carbamoyl]-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H]2[C@H](C(=O)O)[C@H]3C=C[C@H]2C3=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25NO4/c1-18(32)19-12-14-22(15-13-19)31-29(33)27-23-16-17-24(28(27)30(34)35)26(23)25(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-17,23-24,27-28H,1H3,(H,31,33)(H,34,35)/t23-,24-,27-,28+/m0/s1 |
| InChIKey | ZJYBFWAHBKJZAT-NQPYUKKHSA-N |
| XLogP | 5.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|