C23H20O4 — CID 10832367
(1S,2S,3R,4R)-7-benzhydrylidene-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 10832367) has the molecular formula C23H20O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1S,2S,3R,4R)-7-benzhydrylidene-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-7-benzhydrylidene-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10832367 |
| Molecular Formula | C23H20O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (1S,2S,3R,4R)-7-benzhydrylidene-3-methoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)O)[C@@H]2C=C[C@H]1C2=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O4/c1-27-23(26)21-17-13-12-16(20(21)22(24)25)19(17)18(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-13,16-17,20-21H,1H3,(H,24,25)/t16-,17+,20+,21-/m1/s1 |
| InChIKey | UUEZAOWAJYZNKM-SQBLYHGDSA-N |
| XLogP | 3.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|