C36H28Br2O4 — CID 11802708
bis[(4-bromophenyl)methyl] (1S,2S,3S,4R)-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 11802708) has the molecular formula C36H28Br2O4 and a molecular weight of 684.42 g/mol. Its IUPAC name is bis[(4-bromophenyl)methyl] (1S,2S,3S,4R)-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[(4-bromophenyl)methyl] (1S,2S,3S,4R)-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11802708 |
| Molecular Formula | C36H28Br2O4 |
| Molecular Weight | 684.42 g/mol |
| Exact Mass | 682.04 |
| IUPAC Name | bis[(4-bromophenyl)methyl] (1S,2S,3S,4R)-7-benzhydrylidenebicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccc(Br)cc1)[C@@H]1[C@@H](C(=O)OCc2ccc(Br)cc2)[C@H]2C=C[C@@H]1C2=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H28Br2O4/c37-27-15-11-23(12-16-27)21-41-35(39)33-29-19-20-30(34(33)36(40)42-22-24-13-17-28(38)18-14-24)32(29)31(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-20,29-30,33-34H,21-22H2/t29-,30+,33-,34-/m0/s1 |
| InChIKey | KZVNMBQXNCZALQ-DDOVKQMLSA-N |
| XLogP | 8.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.42 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|