C30H23NO4 — CID 3856530
methyl 3-(10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate (PubChem CID 3856530) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is methyl 3-(10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate.
| Compound Name | methyl 3-(10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
|---|---|
| PubChem CID | 3856530 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | methyl 3-(10-benzhydrylidene-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C3C4C=CC(C4=C(c4ccccc4)c4ccccc4)C3C2=O)c1 |
| InChI | InChI=1S/C30H23NO4/c1-35-30(34)20-13-8-14-21(17-20)31-28(32)26-22-15-16-23(27(26)29(31)33)25(22)24(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-17,22-23,26-27H,1H3 |
| InChIKey | KFESUTYCOAGCAU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|