C28H20BrNO2 — CID 2871616
10-benzhydrylidene-4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 2871616) has the molecular formula C28H20BrNO2 and a molecular weight of 482.38 g/mol. Its IUPAC name is 10-benzhydrylidene-4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-benzhydrylidene-4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 2871616 |
| Molecular Formula | C28H20BrNO2 |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | 10-benzhydrylidene-4-(3-bromophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3=C(c3ccccc3)c3ccccc3)C2C(=O)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C28H20BrNO2/c29-19-12-7-13-20(16-19)30-27(31)25-21-14-15-22(26(25)28(30)32)24(21)23(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-16,21-22,25-26H |
| InChIKey | LIKKPYHHTRGSFE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|