C28H20FNO2 — CID 98198979
(1R,2S,6S,7R)-10-benzhydrylidene-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 98198979) has the molecular formula C28H20FNO2 and a molecular weight of 421.47 g/mol. Its IUPAC name is (1R,2S,6S,7R)-10-benzhydrylidene-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-10-benzhydrylidene-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 98198979 |
| Molecular Formula | C28H20FNO2 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (1R,2S,6S,7R)-10-benzhydrylidene-4-(4-fluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(F)cc1)[C@H]1C=C[C@H]2C1=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H20FNO2/c29-19-11-13-20(14-12-19)30-27(31)25-21-15-16-22(26(25)28(30)32)24(21)23(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-16,21-22,25-26H/t21-,22-,25-,26-/m0/s1 |
| InChIKey | VXKOXQSDVLPQFM-JPMIEVGJSA-N |
| XLogP | 5.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|