C28H16F5NO2 — CID 99722702
(1R,2S,6S,7R)-10-benzhydrylidene-4-(2,3,4,5,6-pentafluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99722702) has the molecular formula C28H16F5NO2 and a molecular weight of 493.43 g/mol. Its IUPAC name is (1R,2S,6S,7R)-10-benzhydrylidene-4-(2,3,4,5,6-pentafluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-10-benzhydrylidene-4-(2,3,4,5,6-pentafluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99722702 |
| Molecular Formula | C28H16F5NO2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | (1R,2S,6S,7R)-10-benzhydrylidene-4-(2,3,4,5,6-pentafluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1c(F)c(F)c(F)c(F)c1F)[C@H]1C=C[C@H]2C1=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H16F5NO2/c29-21-22(30)24(32)26(25(33)23(21)31)34-27(35)19-15-11-12-16(20(19)28(34)36)18(15)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12,15-16,19-20H/t15-,16-,19-,20-/m0/s1 |
| InChIKey | RKKPOMVVWXFLBL-FVCZOJIISA-N |
| XLogP | 5.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|