C28H16Br2F3NO2 — CID 43835862
10-[bis(4-bromophenyl)methylidene]-4-(2,4,6-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 43835862) has the molecular formula C28H16Br2F3NO2 and a molecular weight of 615.24 g/mol. Its IUPAC name is 10-[bis(4-bromophenyl)methylidene]-4-(2,4,6-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-[bis(4-bromophenyl)methylidene]-4-(2,4,6-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 43835862 |
| Molecular Formula | C28H16Br2F3NO2 |
| Molecular Weight | 615.24 g/mol |
| Exact Mass | 612.95 |
| IUPAC Name | 10-[bis(4-bromophenyl)methylidene]-4-(2,4,6-trifluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3=C(c3ccc(Br)cc3)c3ccc(Br)cc3)C2C(=O)N1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C28H16Br2F3NO2/c29-15-5-1-13(2-6-15)22(14-3-7-16(30)8-4-14)23-18-9-10-19(23)25-24(18)27(35)34(28(25)36)26-20(32)11-17(31)12-21(26)33/h1-12,18-19,24-25H |
| InChIKey | SSZRWWDJYJEZOJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.24 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|