C23H20BrNO2 — CID 139250301
(3aR,4S,6R,6aS)-2-(4-bromophenyl)-6-ethenyl-4-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 139250301) has the molecular formula C23H20BrNO2 and a molecular weight of 422.32 g/mol. Its IUPAC name is (3aR,4S,6R,6aS)-2-(4-bromophenyl)-6-ethenyl-4-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | (3aR,4S,6R,6aS)-2-(4-bromophenyl)-6-ethenyl-4-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 139250301 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (3aR,4S,6R,6aS)-2-(4-bromophenyl)-6-ethenyl-4-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | C=C[C@H]1C[C@@H](/C=C/c2ccccc2)[C@H]2C(=O)N(c3ccc(Br)cc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C23H20BrNO2/c1-2-16-14-17(9-8-15-6-4-3-5-7-15)21-20(16)22(26)25(23(21)27)19-12-10-18(24)11-13-19/h2-13,16-17,20-21H,1,14H2/b9-8+/t16-,17+,20-,21+/m0/s1 |
| InChIKey | QNMGFPCYMFOWSJ-FTSREJJTSA-N |
| XLogP | 5.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|