C22H19ClN2O2S — CID 99023391
(1R,2S,7R,8R)-10-(4-chlorophenyl)-7-[(E)-2-phenylethenyl]-4-thia-6,10-diazatricyclo[6.3.0.02,6]undecane-9,11-dione (PubChem CID 99023391) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is (1R,2S,7R,8R)-10-(4-chlorophenyl)-7-[(E)-2-phenylethenyl]-4-thia-6,10-diazatricyclo[6.3.0.02,6]undecane-9,11-dione.
| Compound Name | (1R,2S,7R,8R)-10-(4-chlorophenyl)-7-[(E)-2-phenylethenyl]-4-thia-6,10-diazatricyclo[6.3.0.02,6]undecane-9,11-dione |
|---|---|
| PubChem CID | 99023391 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (1R,2S,7R,8R)-10-(4-chlorophenyl)-7-[(E)-2-phenylethenyl]-4-thia-6,10-diazatricyclo[6.3.0.02,6]undecane-9,11-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(Cl)cc1)[C@H]1CSCN1[C@@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H19ClN2O2S/c23-15-7-9-16(10-8-15)25-21(26)19-17(11-6-14-4-2-1-3-5-14)24-13-28-12-18(24)20(19)22(25)27/h1-11,17-20H,12-13H2/b11-6+/t17-,18-,19+,20+/m1/s1 |
| InChIKey | UNKLTRXXWKZTPX-QACNQIRISA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|