C22H16ClNO2 — CID 71556473
1-(4-chlorophenyl)-3,4-diphenylpyrrolidine-2,5-dione (PubChem CID 71556473) has the molecular formula C22H16ClNO2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,4-diphenylpyrrolidine-2,5-dione.
| Compound Name | 1-(4-chlorophenyl)-3,4-diphenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71556473 |
| Molecular Formula | C22H16ClNO2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3,4-diphenylpyrrolidine-2,5-dione |
| SMILES | O=C1C(c2ccccc2)C(c2ccccc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClNO2/c23-17-11-13-18(14-12-17)24-21(25)19(15-7-3-1-4-8-15)20(22(24)26)16-9-5-2-6-10-16/h1-14,19-20H |
| InChIKey | FWSPABWMBYWPOA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|