C29H20ClNO2 — CID 4593075
3-(4-chlorophenyl)-1,6,6-triphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 4593075) has the molecular formula C29H20ClNO2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,6,6-triphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(4-chlorophenyl)-1,6,6-triphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 4593075 |
| Molecular Formula | C29H20ClNO2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-(4-chlorophenyl)-1,6,6-triphenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2C(c3ccccc3)(C(=O)N1c1ccc(Cl)cc1)C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H20ClNO2/c30-23-16-18-24(19-17-23)31-26(32)25-28(20-10-4-1-5-11-20,21-12-6-2-7-13-21)29(25,27(31)33)22-14-8-3-9-15-22/h1-19,25H |
| InChIKey | AEVLUTIKJJHCAL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|