C19H22N2O2 — CID 134846110
(3aR,4R,9aR,9bS)-2-methyl-4-[(E)-2-phenylethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione (PubChem CID 134846110) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (3aR,4R,9aR,9bS)-2-methyl-4-[(E)-2-phenylethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione.
| Compound Name | (3aR,4R,9aR,9bS)-2-methyl-4-[(E)-2-phenylethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione |
|---|---|
| PubChem CID | 134846110 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (3aR,4R,9aR,9bS)-2-methyl-4-[(E)-2-phenylethenyl]-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizine-1,3-dione |
| SMILES | CN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1CCCCN1[C@@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-20-18(22)16-14-9-5-6-12-21(14)15(17(16)19(20)23)11-10-13-7-3-2-4-8-13/h2-4,7-8,10-11,14-17H,5-6,9,12H2,1H3/b11-10+/t14-,15-,16-,17+/m1/s1 |
| InChIKey | CMQDYBKISUGRKA-MJGYBZEVSA-N |
| XLogP | 2.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|