C16H21NO — CID 70581540
1-hydroxy-2-(2-phenylethenyl)-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 70581540) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-hydroxy-2-(2-phenylethenyl)-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-hydroxy-2-(2-phenylethenyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 70581540 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-hydroxy-2-(2-phenylethenyl)-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | ON1C(C=Cc2ccccc2)CC2CCCCC21 |
| InChI | InChI=1S/C16H21NO/c18-17-15(11-10-13-6-2-1-3-7-13)12-14-8-4-5-9-16(14)17/h1-3,6-7,10-11,14-16,18H,4-5,8-9,12H2 |
| InChIKey | OWMPYLIFJZVBKR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |