C19H21N — CID 10563534
1-benzyl-2-[(E)-2-phenylethenyl]pyrrolidine (PubChem CID 10563534) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-benzyl-2-[(E)-2-phenylethenyl]pyrrolidine.
| Compound Name | 1-benzyl-2-[(E)-2-phenylethenyl]pyrrolidine |
|---|---|
| PubChem CID | 10563534 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-benzyl-2-[(E)-2-phenylethenyl]pyrrolidine |
| SMILES | C(=C/C1CCCN1Cc1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C19H21N/c1-3-8-17(9-4-1)13-14-19-12-7-15-20(19)16-18-10-5-2-6-11-18/h1-6,8-11,13-14,19H,7,12,15-16H2/b14-13+ |
| InChIKey | BLCWPLHLOOTWJF-BUHFOSPRSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |