C23H29N — CID 100963528
(2S)-1-benzyl-2-[(E)-3-(2,6-dimethylphenyl)prop-1-enyl]piperidine (PubChem CID 100963528) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is (2S)-1-benzyl-2-[(E)-3-(2,6-dimethylphenyl)prop-1-enyl]piperidine.
| Compound Name | (2S)-1-benzyl-2-[(E)-3-(2,6-dimethylphenyl)prop-1-enyl]piperidine |
|---|---|
| PubChem CID | 100963528 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2S)-1-benzyl-2-[(E)-3-(2,6-dimethylphenyl)prop-1-enyl]piperidine |
| SMILES | Cc1cccc(C)c1C/C=C/[C@@H]1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H29N/c1-19-10-8-11-20(2)23(19)16-9-15-22-14-6-7-17-24(22)18-21-12-4-3-5-13-21/h3-5,8-13,15,22H,6-7,14,16-18H2,1-2H3/b15-9+/t22-/m0/s1 |
| InChIKey | MGBULHVUZLJYHW-OZOJFGJPSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|