C16H21NO2 — CID 100980748
ethyl (E)-3-[(2R)-1-benzylpyrrolidin-2-yl]prop-2-enoate (PubChem CID 100980748) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl (E)-3-[(2R)-1-benzylpyrrolidin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R)-1-benzylpyrrolidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 100980748 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl (E)-3-[(2R)-1-benzylpyrrolidin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c1-2-19-16(18)11-10-15-9-6-12-17(15)13-14-7-4-3-5-8-14/h3-5,7-8,10-11,15H,2,6,9,12-13H2,1H3/b11-10+/t15-/m1/s1 |
| InChIKey | PRPPOEWKUCSXJF-AUECHBEKSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|