C21H25NO — CID 53311038
(4aR,8aS)-1-hydroxy-2,4-diphenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 53311038) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (4aR,8aS)-1-hydroxy-2,4-diphenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aR,8aS)-1-hydroxy-2,4-diphenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 53311038 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (4aR,8aS)-1-hydroxy-2,4-diphenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | ON1C(c2ccccc2)CC(c2ccccc2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H25NO/c23-22-20-14-8-7-13-18(20)19(16-9-3-1-4-10-16)15-21(22)17-11-5-2-6-12-17/h1-6,9-12,18-21,23H,7-8,13-15H2/t18-,19?,20+,21?/m1/s1 |
| InChIKey | PQHQNTYSRLZOMF-OSIBBQKWSA-N |
| XLogP | 5.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |