C16H16OS — CID 144931057
3,5-diphenylthiolan-2-ol (PubChem CID 144931057) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 3,5-diphenylthiolan-2-ol.
| Compound Name | 3,5-diphenylthiolan-2-ol |
|---|---|
| PubChem CID | 144931057 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3,5-diphenylthiolan-2-ol |
| SMILES | OC1SC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C16H16OS/c17-16-14(12-7-3-1-4-8-12)11-15(18-16)13-9-5-2-6-10-13/h1-10,14-17H,11H2 |
| InChIKey | FLMKIHOYUVSEPW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |