C16H16S2 — CID 15501260
2,6-diphenyl-1,4-dithiane (PubChem CID 15501260) has the molecular formula C16H16S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2,6-diphenyl-1,4-dithiane.
| Compound Name | 2,6-diphenyl-1,4-dithiane |
|---|---|
| PubChem CID | 15501260 |
| Molecular Formula | C16H16S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2,6-diphenyl-1,4-dithiane |
| SMILES | c1ccc(C2CSCC(c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C16H16S2/c1-3-7-13(8-4-1)15-11-17-12-16(18-15)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | YYAKQLJLPMAARD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |