About 2-methyl-4-phenyl-1,3,2-dithialumolane
2-methyl-4-phenyl-1,3,2-dithialumolane (PubChem CID 153438524) has the molecular formula C9H11AlS2
and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-methyl-4-phenyl-1,3,2-dithialumolane.
Molecular Properties
| Compound Name | 2-methyl-4-phenyl-1,3,2-dithialumolane |
| PubChem CID | 153438524 |
| Molecular Formula | C9H11AlS2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2-methyl-4-phenyl-1,3,2-dithialumolane |
| SMILES | C[Al]1SCC(c2ccccc2)S1 |
| InChI | InChI=1S/C8H10S2.CH3.Al/c9-6-8(10)7-4-2-1-3-5-7;;/h1-5,8-10H,6H2;1H3;/q;;+2/p-2 |
| InChIKey | PQSHDYPWNYKZGR-UHFFFAOYSA-L |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-phenyl-1,3,2-dithialumolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyl-1,3,2-dithialumolane?
The IUPAC name of 2-methyl-4-phenyl-1,3,2-dithialumolane (CID 153438524) is 2-methyl-4-phenyl-1,3,2-dithialumolane.
What is the SMILES notation for 2-methyl-4-phenyl-1,3,2-dithialumolane?
The canonical SMILES for 2-methyl-4-phenyl-1,3,2-dithialumolane is C[Al]1SCC(c2ccccc2)S1.
What is the InChIKey of 2-methyl-4-phenyl-1,3,2-dithialumolane?
The InChIKey is PQSHDYPWNYKZGR-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10S2.CH3.Al/c9-6-8(10)7-4-2-1-3-5-7;;/h1-5,8-10H,6H2;1H3;/q;;+2/p-2.
What are the key properties of 2-methyl-4-phenyl-1,3,2-dithialumolane?
2-methyl-4-phenyl-1,3,2-dithialumolane has a molecular weight of 210.30 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyl-1,3,2-dithialumolane is sourced from PubChem (CID 153438524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).