C18H22Si — CID 13168396
1,1-dimethyl-2,5-diphenylsilolane (PubChem CID 13168396) has the molecular formula C18H22Si and a molecular weight of 266.46 g/mol. Its IUPAC name is 1,1-dimethyl-2,5-diphenylsilolane.
| Compound Name | 1,1-dimethyl-2,5-diphenylsilolane |
|---|---|
| PubChem CID | 13168396 |
| Molecular Formula | C18H22Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1,1-dimethyl-2,5-diphenylsilolane |
| SMILES | C[Si]1(C)C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C18H22Si/c1-19(2)17(15-9-5-3-6-10-15)13-14-18(19)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3 |
| InChIKey | CEHDDKODEPDHGS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|