C17H19P — CID 87307913
(2R,5R)-1-methyl-2,5-diphenylphospholane (PubChem CID 87307913) has the molecular formula C17H19P and a molecular weight of 254.31 g/mol. Its IUPAC name is (2R,5R)-1-methyl-2,5-diphenylphospholane.
| Compound Name | (2R,5R)-1-methyl-2,5-diphenylphospholane |
|---|---|
| PubChem CID | 87307913 |
| Molecular Formula | C17H19P |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2R,5R)-1-methyl-2,5-diphenylphospholane |
| SMILES | CP1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19P/c1-18-16(14-8-4-2-5-9-14)12-13-17(18)15-10-6-3-7-11-15/h2-11,16-17H,12-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | WLLVNXFJBNEYSX-IAGOWNOFSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|