C24H35NP2 — CID 138466209
(2S,5S)-N-butyl-N-diethylphosphanyl-2,5-diphenylphospholan-1-amine (PubChem CID 138466209) has the molecular formula C24H35NP2 and a molecular weight of 399.50 g/mol. Its IUPAC name is (2S,5S)-N-butyl-N-diethylphosphanyl-2,5-diphenylphospholan-1-amine.
| Compound Name | (2S,5S)-N-butyl-N-diethylphosphanyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 138466209 |
| Molecular Formula | C24H35NP2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2S,5S)-N-butyl-N-diethylphosphanyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(CC)CC)P1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H35NP2/c1-4-7-20-25(26(5-2)6-3)27-23(21-14-10-8-11-15-21)18-19-24(27)22-16-12-9-13-17-22/h8-17,23-24H,4-7,18-20H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | KYPVFOVJWNKWFD-ZEQRLZLVSA-N |
| XLogP | 8.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|