C43H41NP2 — CID 148956825
(2S,5S)-N-bis(3-phenylphenyl)phosphanyl-2,5-diphenyl-N-propylphospholan-1-amine (PubChem CID 148956825) has the molecular formula C43H41NP2 and a molecular weight of 633.76 g/mol. Its IUPAC name is (2S,5S)-N-bis(3-phenylphenyl)phosphanyl-2,5-diphenyl-N-propylphospholan-1-amine.
| Compound Name | (2S,5S)-N-bis(3-phenylphenyl)phosphanyl-2,5-diphenyl-N-propylphospholan-1-amine |
|---|---|
| PubChem CID | 148956825 |
| Molecular Formula | C43H41NP2 |
| Molecular Weight | 633.76 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | (2S,5S)-N-bis(3-phenylphenyl)phosphanyl-2,5-diphenyl-N-propylphospholan-1-amine |
| SMILES | CCCN(P(c1cccc(-c2ccccc2)c1)c1cccc(-c2ccccc2)c1)P1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C43H41NP2/c1-2-31-44(46-42(36-21-11-5-12-22-36)29-30-43(46)37-23-13-6-14-24-37)45(40-27-15-25-38(32-40)34-17-7-3-8-18-34)41-28-16-26-39(33-41)35-19-9-4-10-20-35/h3-28,32-33,42-43H,2,29-31H2,1H3/t42-,43-/m0/s1 |
| InChIKey | PRAJPMHHNUJIMF-MJPWBCPGSA-N |
| XLogP | 11.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.76 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|