C32H29F6NP2 — CID 140850127
N-bis(3,4,5-trifluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine (PubChem CID 140850127) has the molecular formula C32H29F6NP2 and a molecular weight of 603.53 g/mol. Its IUPAC name is N-bis(3,4,5-trifluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine.
| Compound Name | N-bis(3,4,5-trifluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 140850127 |
| Molecular Formula | C32H29F6NP2 |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-bis(3,4,5-trifluorophenyl)phosphanyl-N-butyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(c1cc(F)c(F)c(F)c1)c1cc(F)c(F)c(F)c1)P1C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C32H29F6NP2/c1-2-3-16-39(41-29(21-10-6-4-7-11-21)14-15-30(41)22-12-8-5-9-13-22)40(23-17-25(33)31(37)26(34)18-23)24-19-27(35)32(38)28(36)20-24/h4-13,17-20,29-30H,2-3,14-16H2,1H3 |
| InChIKey | GYZMRMVCUDYVJJ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|