C36H37NP2 — CID 138466205
(2S,5S)-N-butyl-N-[naphthalen-1-yl(phenyl)phosphanyl]-2,5-diphenylphospholan-1-amine (PubChem CID 138466205) has the molecular formula C36H37NP2 and a molecular weight of 545.65 g/mol. Its IUPAC name is (2S,5S)-N-butyl-N-[naphthalen-1-yl(phenyl)phosphanyl]-2,5-diphenylphospholan-1-amine.
| Compound Name | (2S,5S)-N-butyl-N-[naphthalen-1-yl(phenyl)phosphanyl]-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 138466205 |
| Molecular Formula | C36H37NP2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (2S,5S)-N-butyl-N-[naphthalen-1-yl(phenyl)phosphanyl]-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(c1ccccc1)c1cccc2ccccc12)P1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C36H37NP2/c1-2-3-28-37(38(32-22-11-6-12-23-32)36-25-15-21-29-16-13-14-24-33(29)36)39-34(30-17-7-4-8-18-30)26-27-35(39)31-19-9-5-10-20-31/h4-25,34-35H,2-3,26-28H2,1H3/t34-,35-,38?/m0/s1 |
| InChIKey | VCGQMLIKVZDRNK-OZLFYJSBSA-N |
| XLogP | 9.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|