C32H35NP2 — CID 134344316
(2S,5S)-N-[(2R)-butan-2-yl]-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine (PubChem CID 134344316) has the molecular formula C32H35NP2 and a molecular weight of 495.59 g/mol. Its IUPAC name is (2S,5S)-N-[(2R)-butan-2-yl]-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine.
| Compound Name | (2S,5S)-N-[(2R)-butan-2-yl]-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 134344316 |
| Molecular Formula | C32H35NP2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (2S,5S)-N-[(2R)-butan-2-yl]-N-diphenylphosphanyl-2,5-diphenylphospholan-1-amine |
| SMILES | CC[C@@H](C)N(P(c1ccccc1)c1ccccc1)P1[C@H](c2ccccc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H35NP2/c1-3-26(2)33(34(29-20-12-6-13-21-29)30-22-14-7-15-23-30)35-31(27-16-8-4-9-17-27)24-25-32(35)28-18-10-5-11-19-28/h4-23,26,31-32H,3,24-25H2,1-2H3/t26-,31+,32+/m1/s1 |
| InChIKey | XHYPTAZLTQHRTG-GWTOPCPNSA-N |
| XLogP | 8.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|