C19H23O2P — CID 90111468
2,5-bis(2-methoxyphenyl)-1-methylphospholane (PubChem CID 90111468) has the molecular formula C19H23O2P and a molecular weight of 314.37 g/mol. Its IUPAC name is 2,5-bis(2-methoxyphenyl)-1-methylphospholane.
| Compound Name | 2,5-bis(2-methoxyphenyl)-1-methylphospholane |
|---|---|
| PubChem CID | 90111468 |
| Molecular Formula | C19H23O2P |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2,5-bis(2-methoxyphenyl)-1-methylphospholane |
| SMILES | COc1ccccc1C1CCC(c2ccccc2OC)P1C |
| InChI | InChI=1S/C19H23O2P/c1-20-16-10-6-4-8-14(16)18-12-13-19(22(18)3)15-9-5-7-11-17(15)21-2/h4-11,18-19H,12-13H2,1-3H3 |
| InChIKey | DJGQDUBVGPCUHD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|