About 4-(2-methoxyphenyl)oxane
4-(2-methoxyphenyl)oxane (PubChem CID 121009799) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)oxane.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)oxane |
| PubChem CID | 121009799 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-(2-methoxyphenyl)oxane |
| SMILES | COc1ccccc1C1CCOCC1 |
| InChI | InChI=1S/C12H16O2/c1-13-12-5-3-2-4-11(12)10-6-8-14-9-7-10/h2-5,10H,6-9H2,1H3 |
| InChIKey | RWGAUBPDRQJOQL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methoxyphenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)oxane?
The IUPAC name of 4-(2-methoxyphenyl)oxane (CID 121009799) is 4-(2-methoxyphenyl)oxane.
What is the SMILES notation for 4-(2-methoxyphenyl)oxane?
The canonical SMILES for 4-(2-methoxyphenyl)oxane is COc1ccccc1C1CCOCC1.
What is the InChIKey of 4-(2-methoxyphenyl)oxane?
The InChIKey is RWGAUBPDRQJOQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-13-12-5-3-2-4-11(12)10-6-8-14-9-7-10/h2-5,10H,6-9H2,1H3.
What are the key properties of 4-(2-methoxyphenyl)oxane?
4-(2-methoxyphenyl)oxane has a molecular weight of 192.26 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)oxane is sourced from PubChem (CID 121009799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).