C10H10N2O3 — CID 94255380
(5R)-5-(2-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 94255380) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (5R)-5-(2-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94255380 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (5R)-5-(2-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccccc1[C@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C10H10N2O3/c1-15-7-5-3-2-4-6(7)8-9(13)12-10(14)11-8/h2-5,8H,1H3,(H2,11,12,13,14)/t8-/m1/s1 |
| InChIKey | MSPRYRCVNUXVKV-MRVPVSSYSA-N |
| XLogP | 0.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|