C16H18NP — CID 175816319
2,5-diphenylphospholan-1-amine (PubChem CID 175816319) has the molecular formula C16H18NP and a molecular weight of 255.30 g/mol. Its IUPAC name is 2,5-diphenylphospholan-1-amine.
| Compound Name | 2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 175816319 |
| Molecular Formula | C16H18NP |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2,5-diphenylphospholan-1-amine |
| SMILES | NP1C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C16H18NP/c17-18-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10,15-16H,11-12,17H2 |
| InChIKey | OQBNNKMEAGHFFH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|