C24H34P2 — CID 122364984
ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane (PubChem CID 122364984) has the molecular formula C24H34P2 and a molecular weight of 384.48 g/mol. Its IUPAC name is ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane.
| Compound Name | ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane |
|---|---|
| PubChem CID | 122364984 |
| Molecular Formula | C24H34P2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane |
| SMILES | CC(C)(C)P(P1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34P2/c1-23(2,3)26(24(4,5)6)25-21(19-13-9-7-10-14-19)17-18-22(25)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | QZRLQSOOAWVCEU-FGZHOGPDSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|