About ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane
ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane (PubChem CID 122364984) has the molecular formula C24H34P2
and a molecular weight of 384.48 g/mol. Its IUPAC name is ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane.
Molecular Properties
| Compound Name | ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane |
| PubChem CID | 122364984 |
| Molecular Formula | C24H34P2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane |
| SMILES | CC(C)(C)P(P1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H34P2/c1-23(2,3)26(24(4,5)6)25-21(19-13-9-7-10-14-19)17-18-22(25)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | QZRLQSOOAWVCEU-FGZHOGPDSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane?
The IUPAC name of ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane (CID 122364984) is ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane.
What is the SMILES notation for ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane?
The canonical SMILES for ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane is CC(C)(C)P(P1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1)C(C)(C)C.
What is the InChIKey of ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane?
The InChIKey is QZRLQSOOAWVCEU-FGZHOGPDSA-N. The full InChI is InChI=1S/C24H34P2/c1-23(2,3)26(24(4,5)6)25-21(19-13-9-7-10-14-19)17-18-22(25)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3/t21-,22-/m1/s1.
What are the key properties of ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane?
ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane has a molecular weight of 384.48 g/mol, XLogP of 8.74, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-[(2R,5R)-2,5-diphenylphospholan-1-yl]phosphane is sourced from PubChem (CID 122364984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).