C23H31P — CID 12010825
ditert-butyl(1,1-diphenylprop-1-en-2-yl)phosphane (PubChem CID 12010825) has the molecular formula C23H31P and a molecular weight of 338.48 g/mol. Its IUPAC name is ditert-butyl(1,1-diphenylprop-1-en-2-yl)phosphane.
| Compound Name | ditert-butyl(1,1-diphenylprop-1-en-2-yl)phosphane |
|---|---|
| PubChem CID | 12010825 |
| Molecular Formula | C23H31P |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ditert-butyl(1,1-diphenylprop-1-en-2-yl)phosphane |
| SMILES | CC(=C(c1ccccc1)c1ccccc1)P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H31P/c1-18(24(22(2,3)4)23(5,6)7)21(19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17H,1-7H3 |
| InChIKey | CYGZMOQFIMJEIT-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|