About tert-butyl benzoate
tert-butyl benzoate (PubChem CID 135038599) has the molecular formula C11H14O2
and a molecular weight of 180.23 g/mol. Its IUPAC name is tert-butyl benzoate.
Molecular Properties
| Compound Name | tert-butyl benzoate |
| PubChem CID | 135038599 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | tert-butyl benzoate |
| SMILES | CC(C)(C)[18O]C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-11(2,3)13-10(12)9-7-5-4-6-8-9/h4-8H,1-3H3/i13+2 |
| InChIKey | LYDRKKWPKKEMNZ-ALWQSETLSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl benzoate?
The IUPAC name of tert-butyl benzoate (CID 135038599) is tert-butyl benzoate.
What is the SMILES notation for tert-butyl benzoate?
The canonical SMILES for tert-butyl benzoate is CC(C)(C)[18O]C(=O)c1ccccc1.
What is the InChIKey of tert-butyl benzoate?
The InChIKey is LYDRKKWPKKEMNZ-ALWQSETLSA-N. The full InChI is InChI=1S/C11H14O2/c1-11(2,3)13-10(12)9-7-5-4-6-8-9/h4-8H,1-3H3/i13+2.
What are the key properties of tert-butyl benzoate?
tert-butyl benzoate has a molecular weight of 180.23 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl benzoate is sourced from PubChem (CID 135038599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).