C21H21P — CID 87306429
1-cyclopenta-2,4-dien-1-yl-2,5-diphenylphospholane (PubChem CID 87306429) has the molecular formula C21H21P and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-2,5-diphenylphospholane.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-2,5-diphenylphospholane |
|---|---|
| PubChem CID | 87306429 |
| Molecular Formula | C21H21P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-2,5-diphenylphospholane |
| SMILES | C1=CC(P2C(c3ccccc3)CCC2c2ccccc2)C=C1 |
| InChI | InChI=1S/C21H21P/c1-3-9-17(10-4-1)20-15-16-21(18-11-5-2-6-12-18)22(20)19-13-7-8-14-19/h1-14,19-21H,15-16H2 |
| InChIKey | VEUWNOZGKMKURG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|