About cyclopenta-2,4-dien-1-ylbenzene
cyclopenta-2,4-dien-1-ylbenzene (PubChem CID 10917557) has the molecular formula C11H10
and a molecular weight of 142.20 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylbenzene.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-ylbenzene |
| PubChem CID | 10917557 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylbenzene |
| SMILES | C1=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C11H10/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9,11H |
| InChIKey | QCYNOMAXDPUXAP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopenta-2,4-dien-1-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-ylbenzene?
The IUPAC name of cyclopenta-2,4-dien-1-ylbenzene (CID 10917557) is cyclopenta-2,4-dien-1-ylbenzene.
What is the SMILES notation for cyclopenta-2,4-dien-1-ylbenzene?
The canonical SMILES for cyclopenta-2,4-dien-1-ylbenzene is C1=CC(c2ccccc2)C=C1.
What is the InChIKey of cyclopenta-2,4-dien-1-ylbenzene?
The InChIKey is QCYNOMAXDPUXAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9,11H.
What are the key properties of cyclopenta-2,4-dien-1-ylbenzene?
cyclopenta-2,4-dien-1-ylbenzene has a molecular weight of 142.20 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-ylbenzene is sourced from PubChem (CID 10917557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).