C11H10 — CID 10917557
cyclopenta-2,4-dien-1-ylbenzene (PubChem CID 10917557) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-ylbenzene.
| Compound Name | cyclopenta-2,4-dien-1-ylbenzene |
|---|---|
| PubChem CID | 10917557 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | cyclopenta-2,4-dien-1-ylbenzene |
| SMILES | C1=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C11H10/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-9,11H |
| InChIKey | QCYNOMAXDPUXAP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |