C13H14ClN — CID 71695758
4-cyclohepta-2,4,6-trien-1-ylaniline;hydrochloride (PubChem CID 71695758) has the molecular formula C13H14ClN and a molecular weight of 219.72 g/mol. Its IUPAC name is 4-cyclohepta-2,4,6-trien-1-ylaniline;hydrochloride.
| Compound Name | 4-cyclohepta-2,4,6-trien-1-ylaniline;hydrochloride |
|---|---|
| PubChem CID | 71695758 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-cyclohepta-2,4,6-trien-1-ylaniline;hydrochloride |
| SMILES | Cl.Nc1ccc(C2C=CC=CC=C2)cc1 |
| InChI | InChI=1S/C13H13N.ClH/c14-13-9-7-12(8-10-13)11-5-3-1-2-4-6-11;/h1-11H,14H2;1H |
| InChIKey | BFTDSHIRMVRZLZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|